C22H23N3O3 — CID 53137800
2-acetyl-N-[(2-methoxyphenyl)methyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxamide (PubChem CID 53137800) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 2-acetyl-N-[(2-methoxyphenyl)methyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxamide.
| Compound Name | 2-acetyl-N-[(2-methoxyphenyl)methyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxamide |
|---|---|
| PubChem CID | 53137800 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 2-acetyl-N-[(2-methoxyphenyl)methyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxamide |
| SMILES | COc1ccccc1CNC(=O)c1ccc2[nH]c3c(c2c1)CN(C(C)=O)CC3 |
| InChI | InChI=1S/C22H23N3O3/c1-14(26)25-10-9-20-18(13-25)17-11-15(7-8-19(17)24-20)22(27)23-12-16-5-3-4-6-21(16)28-2/h3-8,11,24H,9-10,12-13H2,1-2H3,(H,23,27) |
| InChIKey | HXDJPXMMZVQGRB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|