C23H32N4O2 — CID 53137814
2-acetyl-N-[2-[cyclohexyl(methyl)amino]ethyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxamide (PubChem CID 53137814) has the molecular formula C23H32N4O2 and a molecular weight of 396.54 g/mol. Its IUPAC name is 2-acetyl-N-[2-[cyclohexyl(methyl)amino]ethyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxamide.
| Compound Name | 2-acetyl-N-[2-[cyclohexyl(methyl)amino]ethyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxamide |
|---|---|
| PubChem CID | 53137814 |
| Molecular Formula | C23H32N4O2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | 2-acetyl-N-[2-[cyclohexyl(methyl)amino]ethyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxamide |
| SMILES | CC(=O)N1CCc2[nH]c3ccc(C(=O)NCCN(C)C4CCCCC4)cc3c2C1 |
| InChI | InChI=1S/C23H32N4O2/c1-16(28)27-12-10-22-20(15-27)19-14-17(8-9-21(19)25-22)23(29)24-11-13-26(2)18-6-4-3-5-7-18/h8-9,14,18,25H,3-7,10-13,15H2,1-2H3,(H,24,29) |
| InChIKey | WQZGODBUFSJOFH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|