C22H21F2N3 — CID 70619119
2-(4-fluorophenyl)-5-(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)pentanenitrile (PubChem CID 70619119) has the molecular formula C22H21F2N3 and a molecular weight of 365.43 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)pentanenitrile.
| Compound Name | 2-(4-fluorophenyl)-5-(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)pentanenitrile |
|---|---|
| PubChem CID | 70619119 |
| Molecular Formula | C22H21F2N3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 2-(4-fluorophenyl)-5-(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)pentanenitrile |
| SMILES | N#CC(CCCN1CCc2[nH]c3ccc(F)cc3c2C1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H21F2N3/c23-17-5-3-15(4-6-17)16(13-25)2-1-10-27-11-9-22-20(14-27)19-12-18(24)7-8-21(19)26-22/h3-8,12,16,26H,1-2,9-11,14H2 |
| InChIKey | MFPPRBZSJFCETK-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 42.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|