C15H15FN4S — CID 122154350
5-[(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methyl]-4-methylthiadiazole (PubChem CID 122154350) has the molecular formula C15H15FN4S and a molecular weight of 302.38 g/mol. Its IUPAC name is 5-[(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methyl]-4-methylthiadiazole.
| Compound Name | 5-[(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methyl]-4-methylthiadiazole |
|---|---|
| PubChem CID | 122154350 |
| Molecular Formula | C15H15FN4S |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 5-[(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methyl]-4-methylthiadiazole |
| SMILES | Cc1nnsc1CN1CCc2[nH]c3ccc(F)cc3c2C1 |
| InChI | InChI=1S/C15H15FN4S/c1-9-15(21-19-18-9)8-20-5-4-14-12(7-20)11-6-10(16)2-3-13(11)17-14/h2-3,6,17H,4-5,7-8H2,1H3 |
| InChIKey | SSDIAUXETANWIG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|