C28H33F2NO6S — CID 146774886
methyl (2R)-3-[(1S,3R)-6-fluoro-1-[6-fluoro-2-methyl-3-(2-methylsulfonyloxyethoxy)phenyl]-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-2-methylpropanoate (PubChem CID 146774886) has the molecular formula C28H33F2NO6S and a molecular weight of 549.64 g/mol. Its IUPAC name is methyl (2R)-3-[(1S,3R)-6-fluoro-1-[6-fluoro-2-methyl-3-(2-methylsulfonyloxyethoxy)phenyl]-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-2-methylpropanoate.
| Compound Name | methyl (2R)-3-[(1S,3R)-6-fluoro-1-[6-fluoro-2-methyl-3-(2-methylsulfonyloxyethoxy)phenyl]-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-2-methylpropanoate |
|---|---|
| PubChem CID | 146774886 |
| Molecular Formula | C28H33F2NO6S |
| Molecular Weight | 549.64 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | methyl (2R)-3-[(1S,3R)-6-fluoro-1-[6-fluoro-2-methyl-3-(2-methylsulfonyloxyethoxy)phenyl]-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-2-methylpropanoate |
| SMILES | COC(=O)[C@H](C)CN1[C@H](C)CC2=C(Cc3ccc(F)cc32)[C@H]1c1c(F)ccc(OCCOS(C)(=O)=O)c1C |
| InChI | InChI=1S/C28H33F2NO6S/c1-16(28(32)35-4)15-31-17(2)12-22-21-14-20(29)7-6-19(21)13-23(22)27(31)26-18(3)25(9-8-24(26)30)36-10-11-37-38(5,33)34/h6-9,14,16-17,27H,10-13,15H2,1-5H3/t16-,17-,27+/m1/s1 |
| InChIKey | RSNNMXUXHYWFDS-YJRQDOMCSA-N |
| XLogP | 4.58 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.64 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|