C28H34FNO6S — CID 147154829
methyl (2S)-3-[(1S,3R)-1-[6-fluoro-2-methyl-3-(2-methylsulfonyloxyethoxy)phenyl]-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-2-methylpropanoate (PubChem CID 147154829) has the molecular formula C28H34FNO6S and a molecular weight of 531.65 g/mol. Its IUPAC name is methyl (2S)-3-[(1S,3R)-1-[6-fluoro-2-methyl-3-(2-methylsulfonyloxyethoxy)phenyl]-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-2-methylpropanoate.
| Compound Name | methyl (2S)-3-[(1S,3R)-1-[6-fluoro-2-methyl-3-(2-methylsulfonyloxyethoxy)phenyl]-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-2-methylpropanoate |
|---|---|
| PubChem CID | 147154829 |
| Molecular Formula | C28H34FNO6S |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.21 |
| IUPAC Name | methyl (2S)-3-[(1S,3R)-1-[6-fluoro-2-methyl-3-(2-methylsulfonyloxyethoxy)phenyl]-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-2-methylpropanoate |
| SMILES | COC(=O)[C@@H](C)CN1[C@H](C)CC2=C(Cc3ccccc32)[C@H]1c1c(F)ccc(OCCOS(C)(=O)=O)c1C |
| InChI | InChI=1S/C28H34FNO6S/c1-17(28(31)34-4)16-30-18(2)14-22-21-9-7-6-8-20(21)15-23(22)27(30)26-19(3)25(11-10-24(26)29)35-12-13-36-37(5,32)33/h6-11,17-18,27H,12-16H2,1-5H3/t17-,18+,27-/m0/s1 |
| InChIKey | BURPYWPOYPUIPG-WNGDZKDKSA-N |
| XLogP | 4.44 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|