C26H25F2NO3 — CID 158221259
(E)-3-[3,5-difluoro-4-[3-methyl-2-(oxetan-3-ylmethyl)-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]phenyl]prop-2-enoic acid (PubChem CID 158221259) has the molecular formula C26H25F2NO3 and a molecular weight of 437.49 g/mol. Its IUPAC name is (E)-3-[3,5-difluoro-4-[3-methyl-2-(oxetan-3-ylmethyl)-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3,5-difluoro-4-[3-methyl-2-(oxetan-3-ylmethyl)-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 158221259 |
| Molecular Formula | C26H25F2NO3 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | (E)-3-[3,5-difluoro-4-[3-methyl-2-(oxetan-3-ylmethyl)-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]phenyl]prop-2-enoic acid |
| SMILES | CC1CC2=C(Cc3ccccc32)C(c2c(F)cc(/C=C/C(=O)O)cc2F)N1CC1COC1 |
| InChI | InChI=1S/C26H25F2NO3/c1-15-8-20-19-5-3-2-4-18(19)11-21(20)26(29(15)12-17-13-32-14-17)25-22(27)9-16(10-23(25)28)6-7-24(30)31/h2-7,9-10,15,17,26H,8,11-14H2,1H3,(H,30,31)/b7-6+ |
| InChIKey | GDGQXAODSQNITE-VOTSOKGWSA-N |
| XLogP | 4.85 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|