C35H38F3NO3 — CID 162229995
4-[5-[3,5-difluoro-4-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]phenoxy]pentyl]benzoic acid (PubChem CID 162229995) has the molecular formula C35H38F3NO3 and a molecular weight of 577.69 g/mol. Its IUPAC name is 4-[5-[3,5-difluoro-4-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]phenoxy]pentyl]benzoic acid.
| Compound Name | 4-[5-[3,5-difluoro-4-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]phenoxy]pentyl]benzoic acid |
|---|---|
| PubChem CID | 162229995 |
| Molecular Formula | C35H38F3NO3 |
| Molecular Weight | 577.69 g/mol |
| Exact Mass | 577.28 |
| IUPAC Name | 4-[5-[3,5-difluoro-4-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]phenoxy]pentyl]benzoic acid |
| SMILES | C[C@@H]1CC2=C(Cc3ccccc32)[C@@H](c2c(F)cc(OCCCCCc3ccc(C(=O)O)cc3)cc2F)N1CC(C)(C)F |
| InChI | InChI=1S/C35H38F3NO3/c1-22-17-28-27-11-7-6-10-25(27)18-29(28)33(39(22)21-35(2,3)38)32-30(36)19-26(20-31(32)37)42-16-8-4-5-9-23-12-14-24(15-13-23)34(40)41/h6-7,10-15,19-20,22,33H,4-5,8-9,16-18,21H2,1-3H3,(H,40,41)/t22-,33+/m1/s1 |
| InChIKey | ZVHGTGXLOPRAKK-NBLPZQPVSA-N |
| XLogP | 8.35 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.69 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|