C35H46F3NO6 — CID 147813656
ethyl 2-[2-[(2S,3S)-3-[2-[3,5-difluoro-4-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]phenoxy]ethoxy]butan-2-yl]oxyethoxy]acetate (PubChem CID 147813656) has the molecular formula C35H46F3NO6 and a molecular weight of 633.75 g/mol. Its IUPAC name is ethyl 2-[2-[(2S,3S)-3-[2-[3,5-difluoro-4-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]phenoxy]ethoxy]butan-2-yl]oxyethoxy]acetate.
| Compound Name | ethyl 2-[2-[(2S,3S)-3-[2-[3,5-difluoro-4-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]phenoxy]ethoxy]butan-2-yl]oxyethoxy]acetate |
|---|---|
| PubChem CID | 147813656 |
| Molecular Formula | C35H46F3NO6 |
| Molecular Weight | 633.75 g/mol |
| Exact Mass | 633.33 |
| IUPAC Name | ethyl 2-[2-[(2S,3S)-3-[2-[3,5-difluoro-4-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]phenoxy]ethoxy]butan-2-yl]oxyethoxy]acetate |
| SMILES | CCOC(=O)COCCO[C@@H](C)[C@H](C)OCCOc1cc(F)c([C@@H]2C3=C(C[C@@H](C)N2CC(C)(C)F)c2ccccc2C3)c(F)c1 |
| InChI | InChI=1S/C35H46F3NO6/c1-7-42-32(40)20-41-12-13-43-23(3)24(4)44-14-15-45-26-18-30(36)33(31(37)19-26)34-29-17-25-10-8-9-11-27(25)28(29)16-22(2)39(34)21-35(5,6)38/h8-11,18-19,22-24,34H,7,12-17,20-21H2,1-6H3/t22-,23+,24+,34+/m1/s1 |
| InChIKey | HNWHFVNYPHTXDR-ZFGOKZCISA-N |
| XLogP | 6.63 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.75 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|