C31H40F3NO2 — CID 158841731
8-[3,5-difluoro-4-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]phenoxy]octan-1-ol (PubChem CID 158841731) has the molecular formula C31H40F3NO2 and a molecular weight of 515.66 g/mol. Its IUPAC name is 8-[3,5-difluoro-4-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]phenoxy]octan-1-ol.
| Compound Name | 8-[3,5-difluoro-4-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]phenoxy]octan-1-ol |
|---|---|
| PubChem CID | 158841731 |
| Molecular Formula | C31H40F3NO2 |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.30 |
| IUPAC Name | 8-[3,5-difluoro-4-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]phenoxy]octan-1-ol |
| SMILES | C[C@@H]1CC2=C(Cc3ccccc32)[C@@H](c2c(F)cc(OCCCCCCCCO)cc2F)N1CC(C)(C)F |
| InChI | InChI=1S/C31H40F3NO2/c1-21-16-25-24-13-9-8-12-22(24)17-26(25)30(35(21)20-31(2,3)34)29-27(32)18-23(19-28(29)33)37-15-11-7-5-4-6-10-14-36/h8-9,12-13,18-19,21,30,36H,4-7,10-11,14-17,20H2,1-3H3/t21-,30+/m1/s1 |
| InChIKey | IYIGANHGIWGEJU-DFXYEROKSA-N |
| XLogP | 7.57 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|