C35H46F3N3O3 — CID 159114495
methyl 4-[4-[3-[3,5-difluoro-4-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]phenoxy]propyl]piperazin-1-yl]butanoate (PubChem CID 159114495) has the molecular formula C35H46F3N3O3 and a molecular weight of 613.76 g/mol. Its IUPAC name is methyl 4-[4-[3-[3,5-difluoro-4-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]phenoxy]propyl]piperazin-1-yl]butanoate.
| Compound Name | methyl 4-[4-[3-[3,5-difluoro-4-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]phenoxy]propyl]piperazin-1-yl]butanoate |
|---|---|
| PubChem CID | 159114495 |
| Molecular Formula | C35H46F3N3O3 |
| Molecular Weight | 613.76 g/mol |
| Exact Mass | 613.35 |
| IUPAC Name | methyl 4-[4-[3-[3,5-difluoro-4-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]phenoxy]propyl]piperazin-1-yl]butanoate |
| SMILES | COC(=O)CCCN1CCN(CCCOc2cc(F)c([C@@H]3C4=C(C[C@@H](C)N3CC(C)(C)F)c3ccccc3C4)c(F)c2)CC1 |
| InChI | InChI=1S/C35H46F3N3O3/c1-24-19-28-27-10-6-5-9-25(27)20-29(28)34(41(24)23-35(2,3)38)33-30(36)21-26(22-31(33)37)44-18-8-13-40-16-14-39(15-17-40)12-7-11-32(42)43-4/h5-6,9-10,21-22,24,34H,7-8,11-20,23H2,1-4H3/t24-,34+/m1/s1 |
| InChIKey | KEXIMTIICQDAML-ZWVRTZEQSA-N |
| XLogP | 6.20 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.76 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|