C36H40F3NO3 — CID 159536862
methyl 4-[5-[3,5-difluoro-4-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]phenoxy]pentyl]benzoate (PubChem CID 159536862) has the molecular formula C36H40F3NO3 and a molecular weight of 591.71 g/mol. Its IUPAC name is methyl 4-[5-[3,5-difluoro-4-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]phenoxy]pentyl]benzoate.
| Compound Name | methyl 4-[5-[3,5-difluoro-4-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]phenoxy]pentyl]benzoate |
|---|---|
| PubChem CID | 159536862 |
| Molecular Formula | C36H40F3NO3 |
| Molecular Weight | 591.71 g/mol |
| Exact Mass | 591.30 |
| IUPAC Name | methyl 4-[5-[3,5-difluoro-4-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]phenoxy]pentyl]benzoate |
| SMILES | COC(=O)c1ccc(CCCCCOc2cc(F)c([C@@H]3C4=C(C[C@@H](C)N3CC(C)(C)F)c3ccccc3C4)c(F)c2)cc1 |
| InChI | InChI=1S/C36H40F3NO3/c1-23-18-29-28-12-8-7-11-26(28)19-30(29)34(40(23)22-36(2,3)39)33-31(37)20-27(21-32(33)38)43-17-9-5-6-10-24-13-15-25(16-14-24)35(41)42-4/h7-8,11-16,20-21,23,34H,5-6,9-10,17-19,22H2,1-4H3/t23-,34+/m1/s1 |
| InChIKey | MDRXMASXYOZBQQ-NHOCJEJCSA-N |
| XLogP | 8.44 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.71 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|