C34H44F3N3O3 — CID 157262070
2-[4-[5-[3,5-difluoro-4-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]phenoxy]pentyl]piperazin-1-yl]acetic acid (PubChem CID 157262070) has the molecular formula C34H44F3N3O3 and a molecular weight of 599.74 g/mol. Its IUPAC name is 2-[4-[5-[3,5-difluoro-4-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]phenoxy]pentyl]piperazin-1-yl]acetic acid.
| Compound Name | 2-[4-[5-[3,5-difluoro-4-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]phenoxy]pentyl]piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 157262070 |
| Molecular Formula | C34H44F3N3O3 |
| Molecular Weight | 599.74 g/mol |
| Exact Mass | 599.33 |
| IUPAC Name | 2-[4-[5-[3,5-difluoro-4-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]phenoxy]pentyl]piperazin-1-yl]acetic acid |
| SMILES | C[C@@H]1CC2=C(Cc3ccccc32)[C@@H](c2c(F)cc(OCCCCCN3CCN(CC(=O)O)CC3)cc2F)N1CC(C)(C)F |
| InChI | InChI=1S/C34H44F3N3O3/c1-23-17-27-26-10-6-5-9-24(26)18-28(27)33(40(23)22-34(2,3)37)32-29(35)19-25(20-30(32)36)43-16-8-4-7-11-38-12-14-39(15-13-38)21-31(41)42/h5-6,9-10,19-20,23,33H,4,7-8,11-18,21-22H2,1-3H3,(H,41,42)/t23-,33+/m1/s1 |
| InChIKey | AXOPNNBOURQQRR-NHRFMIRVSA-N |
| XLogP | 6.11 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.74 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|