C29H36F2N2O — CID 161080768
(1R,3R)-1-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine (PubChem CID 161080768) has the molecular formula C29H36F2N2O and a molecular weight of 466.62 g/mol. Its IUPAC name is (1R,3R)-1-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine.
| Compound Name | (1R,3R)-1-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine |
|---|---|
| PubChem CID | 161080768 |
| Molecular Formula | C29H36F2N2O |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | (1R,3R)-1-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine |
| SMILES | C[C@@H]1CC2=C(Cc3ccccc32)[C@@H](c2ccc(OCCN3CC(CF)C3)cc2)N1CC(C)(C)F |
| InChI | InChI=1S/C29H36F2N2O/c1-20-14-26-25-7-5-4-6-23(25)15-27(26)28(33(20)19-29(2,3)31)22-8-10-24(11-9-22)34-13-12-32-17-21(16-30)18-32/h4-11,20-21,28H,12-19H2,1-3H3/t20-,28-/m1/s1 |
| InChIKey | UFWPGLPKMGQLGV-PIIWDFAUSA-N |
| XLogP | 5.86 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |