C26H28FNO2 — CID 148603901
(E)-3-[4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]phenyl]prop-2-enoic acid (PubChem CID 148603901) has the molecular formula C26H28FNO2 and a molecular weight of 405.51 g/mol. Its IUPAC name is (E)-3-[4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 148603901 |
| Molecular Formula | C26H28FNO2 |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | (E)-3-[4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]phenyl]prop-2-enoic acid |
| SMILES | C[C@@H]1CC2=C(Cc3ccccc32)[C@@H](c2ccc(/C=C/C(=O)O)cc2)N1CC(C)(C)F |
| InChI | InChI=1S/C26H28FNO2/c1-17-14-22-21-7-5-4-6-20(21)15-23(22)25(28(17)16-26(2,3)27)19-11-8-18(9-12-19)10-13-24(29)30/h4-13,17,25H,14-16H2,1-3H3,(H,29,30)/b13-10+/t17-,25-/m1/s1 |
| InChIKey | NDAKXEDCKVHWMP-DMPFGEPASA-N |
| XLogP | 5.68 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|