C28H33F4N3O — CID 146559453
(1R,3S)-1-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,5-tetrahydropyrido[3,4-b]indole (PubChem CID 146559453) has the molecular formula C28H33F4N3O and a molecular weight of 503.58 g/mol. Its IUPAC name is (1R,3S)-1-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,5-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1R,3S)-1-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,5-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 146559453 |
| Molecular Formula | C28H33F4N3O |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.26 |
| IUPAC Name | (1R,3S)-1-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,5-tetrahydropyrido[3,4-b]indole |
| SMILES | C[C@H]1CC2=C3CC=CC=C3N=C2[C@@H](c2c(F)cc(OCCN3CC(CF)C3)cc2F)N1CC(C)(C)F |
| InChI | InChI=1S/C28H33F4N3O/c1-17-10-21-20-6-4-5-7-24(20)33-26(21)27(35(17)16-28(2,3)32)25-22(30)11-19(12-23(25)31)36-9-8-34-14-18(13-29)15-34/h4-5,7,11-12,17-18,27H,6,8-10,13-16H2,1-3H3/t17-,27+/m0/s1 |
| InChIKey | KPGLFHXGDLZTFR-CBZJRKILSA-N |
| XLogP | 5.72 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |