C20H18F2INO2S — CID 160788769
(1S,3R)-1-(2,6-difluoro-4-iodophenyl)-3-methyl-2-methylsulfonyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine (PubChem CID 160788769) has the molecular formula C20H18F2INO2S and a molecular weight of 501.34 g/mol. Its IUPAC name is (1S,3R)-1-(2,6-difluoro-4-iodophenyl)-3-methyl-2-methylsulfonyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine.
| Compound Name | (1S,3R)-1-(2,6-difluoro-4-iodophenyl)-3-methyl-2-methylsulfonyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine |
|---|---|
| PubChem CID | 160788769 |
| Molecular Formula | C20H18F2INO2S |
| Molecular Weight | 501.34 g/mol |
| Exact Mass | 501.01 |
| IUPAC Name | (1S,3R)-1-(2,6-difluoro-4-iodophenyl)-3-methyl-2-methylsulfonyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine |
| SMILES | C[C@@H]1CC2=C(Cc3ccccc32)[C@@H](c2c(F)cc(I)cc2F)N1S(C)(=O)=O |
| InChI | InChI=1S/C20H18F2INO2S/c1-11-7-15-14-6-4-3-5-12(14)8-16(15)20(24(11)27(2,25)26)19-17(21)9-13(23)10-18(19)22/h3-6,9-11,20H,7-8H2,1-2H3/t11-,20+/m1/s1 |
| InChIKey | SBOJBYVJEIKPKT-GIPWTMENSA-N |
| XLogP | 4.67 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.34 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|