C31H35F3N2O — CID 164982259
(1S,3R)-2-(1-bicyclo[1.1.1]pentanyl)-1-[2,6-difluoro-4-[(3R)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine (PubChem CID 164982259) has the molecular formula C31H35F3N2O and a molecular weight of 508.63 g/mol. Its IUPAC name is (1S,3R)-2-(1-bicyclo[1.1.1]pentanyl)-1-[2,6-difluoro-4-[(3R)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine.
| Compound Name | (1S,3R)-2-(1-bicyclo[1.1.1]pentanyl)-1-[2,6-difluoro-4-[(3R)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine |
|---|---|
| PubChem CID | 164982259 |
| Molecular Formula | C31H35F3N2O |
| Molecular Weight | 508.63 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | (1S,3R)-2-(1-bicyclo[1.1.1]pentanyl)-1-[2,6-difluoro-4-[(3R)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine |
| SMILES | C[C@@H]1CC2=C(Cc3ccccc32)[C@@H](c2c(F)cc(O[C@@H]3CCN(CCCF)C3)cc2F)N1C12CC(C1)C2 |
| InChI | InChI=1S/C31H35F3N2O/c1-19-11-25-24-6-3-2-5-21(24)12-26(25)30(36(19)31-15-20(16-31)17-31)29-27(33)13-23(14-28(29)34)37-22-7-10-35(18-22)9-4-8-32/h2-3,5-6,13-14,19-20,22,30H,4,7-12,15-18H2,1H3/t19-,20?,22-,30+,31?/m1/s1 |
| InChIKey | FQVHOSAEJZYXCO-CKSNFRIQSA-N |
| XLogP | 6.48 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.63 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |