C32H36F3N3O2 — CID 167542546
3-[(1R,3S)-1-[2,6-difluoro-4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]bicyclo[1.1.1]pentane-1-carboxamide (PubChem CID 167542546) has the molecular formula C32H36F3N3O2 and a molecular weight of 551.65 g/mol. Its IUPAC name is 3-[(1R,3S)-1-[2,6-difluoro-4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]bicyclo[1.1.1]pentane-1-carboxamide.
| Compound Name | 3-[(1R,3S)-1-[2,6-difluoro-4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]bicyclo[1.1.1]pentane-1-carboxamide |
|---|---|
| PubChem CID | 167542546 |
| Molecular Formula | C32H36F3N3O2 |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 551.28 |
| IUPAC Name | 3-[(1R,3S)-1-[2,6-difluoro-4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]bicyclo[1.1.1]pentane-1-carboxamide |
| SMILES | C[C@H]1CC2=C(Cc3ccccc32)[C@H](c2c(F)cc(OC3CCN(CCCF)C3)cc2F)N1C12CC(C(N)=O)(C1)C2 |
| InChI | InChI=1S/C32H36F3N3O2/c1-19-11-24-23-6-3-2-5-20(23)12-25(24)29(38(19)32-16-31(17-32,18-32)30(36)39)28-26(34)13-22(14-27(28)35)40-21-7-10-37(15-21)9-4-8-33/h2-3,5-6,13-14,19,21,29H,4,7-12,15-18H2,1H3,(H2,36,39)/t19-,21?,29+,31?,32?/m0/s1 |
| InChIKey | UWNYEDOQKRLZSB-FLHXUOPUSA-N |
| XLogP | 5.33 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |