C28H34N4O — CID 164997557
2-[3-[[5-[(1S,3R)-2-(1-bicyclo[1.1.1]pentanyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]-2-pyridinyl]amino]azetidin-1-yl]ethanol (PubChem CID 164997557) has the molecular formula C28H34N4O and a molecular weight of 442.61 g/mol. Its IUPAC name is 2-[3-[[5-[(1S,3R)-2-(1-bicyclo[1.1.1]pentanyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]-2-pyridinyl]amino]azetidin-1-yl]ethanol.
| Compound Name | 2-[3-[[5-[(1S,3R)-2-(1-bicyclo[1.1.1]pentanyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]-2-pyridinyl]amino]azetidin-1-yl]ethanol |
|---|---|
| PubChem CID | 164997557 |
| Molecular Formula | C28H34N4O |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | 2-[3-[[5-[(1S,3R)-2-(1-bicyclo[1.1.1]pentanyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]-2-pyridinyl]amino]azetidin-1-yl]ethanol |
| SMILES | C[C@@H]1CC2=C(Cc3ccccc32)[C@@H](c2ccc(NC3CN(CCO)C3)nc2)N1C12CC(C1)C2 |
| InChI | InChI=1S/C28H34N4O/c1-18-10-24-23-5-3-2-4-20(23)11-25(24)27(32(18)28-12-19(13-28)14-28)21-6-7-26(29-15-21)30-22-16-31(17-22)8-9-33/h2-7,15,18-19,22,27,33H,8-14,16-17H2,1H3,(H,29,30)/t18-,19?,27-,28?/m1/s1 |
| InChIKey | GFWDUAOZBZRFJK-QWMXRCOESA-N |
| XLogP | 3.87 |
| TPSA | 51.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |