C27H30ClF4N3O3 — CID 158418952
(2S)-3-[(1S,3S)-1-[3-chloro-5-fluoro-2-[2-(3-fluoropropylamino)ethoxy]-4-pyridinyl]-3-(difluoromethyl)-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-2-methylpropanoic acid (PubChem CID 158418952) has the molecular formula C27H30ClF4N3O3 and a molecular weight of 556.00 g/mol. Its IUPAC name is (2S)-3-[(1S,3S)-1-[3-chloro-5-fluoro-2-[2-(3-fluoropropylamino)ethoxy]-4-pyridinyl]-3-(difluoromethyl)-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-2-methylpropanoic acid.
| Compound Name | (2S)-3-[(1S,3S)-1-[3-chloro-5-fluoro-2-[2-(3-fluoropropylamino)ethoxy]-4-pyridinyl]-3-(difluoromethyl)-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 158418952 |
| Molecular Formula | C27H30ClF4N3O3 |
| Molecular Weight | 556.00 g/mol |
| Exact Mass | 555.19 |
| IUPAC Name | (2S)-3-[(1S,3S)-1-[3-chloro-5-fluoro-2-[2-(3-fluoropropylamino)ethoxy]-4-pyridinyl]-3-(difluoromethyl)-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-2-methylpropanoic acid |
| SMILES | C[C@@H](CN1[C@H](c2c(F)cnc(OCCNCCCF)c2Cl)C2=C(C[C@H]1C(F)F)c1ccccc1C2)C(=O)O |
| InChI | InChI=1S/C27H30ClF4N3O3/c1-15(27(36)37)14-35-21(25(31)32)12-18-17-6-3-2-5-16(17)11-19(18)24(35)22-20(30)13-34-26(23(22)28)38-10-9-33-8-4-7-29/h2-3,5-6,13,15,21,24-25,33H,4,7-12,14H2,1H3,(H,36,37)/t15-,21-,24-/m0/s1 |
| InChIKey | HAGFDADSXRJCNE-WIRXAFICSA-N |
| XLogP | 5.31 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.00 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|