C29H37F2N3O2 — CID 158784155
(2S)-3-[(1S,3R)-1-[6-fluoro-3-[2-(3-fluoropropylamino)ethylamino]-2-methylphenyl]-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-2-methylpropanoic acid (PubChem CID 158784155) has the molecular formula C29H37F2N3O2 and a molecular weight of 497.63 g/mol. Its IUPAC name is (2S)-3-[(1S,3R)-1-[6-fluoro-3-[2-(3-fluoropropylamino)ethylamino]-2-methylphenyl]-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-2-methylpropanoic acid.
| Compound Name | (2S)-3-[(1S,3R)-1-[6-fluoro-3-[2-(3-fluoropropylamino)ethylamino]-2-methylphenyl]-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 158784155 |
| Molecular Formula | C29H37F2N3O2 |
| Molecular Weight | 497.63 g/mol |
| Exact Mass | 497.29 |
| IUPAC Name | (2S)-3-[(1S,3R)-1-[6-fluoro-3-[2-(3-fluoropropylamino)ethylamino]-2-methylphenyl]-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-2-methylpropanoic acid |
| SMILES | Cc1c(NCCNCCCF)ccc(F)c1[C@@H]1C2=C(C[C@@H](C)N1C[C@H](C)C(=O)O)c1ccccc1C2 |
| InChI | InChI=1S/C29H37F2N3O2/c1-18(29(35)36)17-34-19(2)15-23-22-8-5-4-7-21(22)16-24(23)28(34)27-20(3)26(10-9-25(27)31)33-14-13-32-12-6-11-30/h4-5,7-10,18-19,28,32-33H,6,11-17H2,1-3H3,(H,35,36)/t18-,19+,28-/m0/s1 |
| InChIKey | IRLPRJCIBMNCFH-ILLIAVPXSA-N |
| XLogP | 5.36 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.63 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|