C27H30F6N2O2 — CID 148545801
3-[(1S,3R)-1-[2,6-difluoro-3-[2-(3-fluoropropylamino)ethoxy]phenyl]-7-fluoro-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-2,2-difluoropropan-1-ol (PubChem CID 148545801) has the molecular formula C27H30F6N2O2 and a molecular weight of 528.54 g/mol. Its IUPAC name is 3-[(1S,3R)-1-[2,6-difluoro-3-[2-(3-fluoropropylamino)ethoxy]phenyl]-7-fluoro-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-2,2-difluoropropan-1-ol.
| Compound Name | 3-[(1S,3R)-1-[2,6-difluoro-3-[2-(3-fluoropropylamino)ethoxy]phenyl]-7-fluoro-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-2,2-difluoropropan-1-ol |
|---|---|
| PubChem CID | 148545801 |
| Molecular Formula | C27H30F6N2O2 |
| Molecular Weight | 528.54 g/mol |
| Exact Mass | 528.22 |
| IUPAC Name | 3-[(1S,3R)-1-[2,6-difluoro-3-[2-(3-fluoropropylamino)ethoxy]phenyl]-7-fluoro-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-2,2-difluoropropan-1-ol |
| SMILES | C[C@@H]1CC2=C(Cc3cc(F)ccc32)[C@@H](c2c(F)ccc(OCCNCCCF)c2F)N1CC(F)(F)CO |
| InChI | InChI=1S/C27H30F6N2O2/c1-16-11-20-19-4-3-18(29)12-17(19)13-21(20)26(35(16)14-27(32,33)15-36)24-22(30)5-6-23(25(24)31)37-10-9-34-8-2-7-28/h3-6,12,16,26,34,36H,2,7-11,13-15H2,1H3/t16-,26+/m1/s1 |
| InChIKey | MTBKQJFRPDAEHF-DXPJPUQTSA-N |
| XLogP | 5.20 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.54 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|