C30H39FN2O3 — CID 147674446
(2S)-3-[(1S,3R)-1-[3-[2-(butylamino)ethoxy]-6-fluoro-2-methylphenyl]-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-2-methylpropanoic acid (PubChem CID 147674446) has the molecular formula C30H39FN2O3 and a molecular weight of 494.65 g/mol. Its IUPAC name is (2S)-3-[(1S,3R)-1-[3-[2-(butylamino)ethoxy]-6-fluoro-2-methylphenyl]-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-2-methylpropanoic acid.
| Compound Name | (2S)-3-[(1S,3R)-1-[3-[2-(butylamino)ethoxy]-6-fluoro-2-methylphenyl]-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 147674446 |
| Molecular Formula | C30H39FN2O3 |
| Molecular Weight | 494.65 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | (2S)-3-[(1S,3R)-1-[3-[2-(butylamino)ethoxy]-6-fluoro-2-methylphenyl]-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-2-methylpropanoic acid |
| SMILES | CCCCNCCOc1ccc(F)c([C@@H]2C3=C(C[C@@H](C)N2C[C@H](C)C(=O)O)c2ccccc2C3)c1C |
| InChI | InChI=1S/C30H39FN2O3/c1-5-6-13-32-14-15-36-27-12-11-26(31)28(21(27)4)29-25-17-22-9-7-8-10-23(22)24(25)16-20(3)33(29)18-19(2)30(34)35/h7-12,19-20,29,32H,5-6,13-18H2,1-4H3,(H,34,35)/t19-,20+,29-/m0/s1 |
| InChIKey | GNWOCLLIANWKAF-LNIFMVABSA-N |
| XLogP | 5.77 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.65 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|