C29H33F5N2O3 — CID 147296326
(2S)-3-[(1S,3S)-1-[6-fluoro-3-[2-(3-fluoropropylamino)ethoxy]-2-methylphenyl]-3-(trifluoromethyl)-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-2-methylpropanoic acid (PubChem CID 147296326) has the molecular formula C29H33F5N2O3 and a molecular weight of 552.58 g/mol. Its IUPAC name is (2S)-3-[(1S,3S)-1-[6-fluoro-3-[2-(3-fluoropropylamino)ethoxy]-2-methylphenyl]-3-(trifluoromethyl)-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-2-methylpropanoic acid.
| Compound Name | (2S)-3-[(1S,3S)-1-[6-fluoro-3-[2-(3-fluoropropylamino)ethoxy]-2-methylphenyl]-3-(trifluoromethyl)-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 147296326 |
| Molecular Formula | C29H33F5N2O3 |
| Molecular Weight | 552.58 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | (2S)-3-[(1S,3S)-1-[6-fluoro-3-[2-(3-fluoropropylamino)ethoxy]-2-methylphenyl]-3-(trifluoromethyl)-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-2-methylpropanoic acid |
| SMILES | Cc1c(OCCNCCCF)ccc(F)c1[C@@H]1C2=C(C[C@@H](C(F)(F)F)N1C[C@H](C)C(=O)O)c1ccccc1C2 |
| InChI | InChI=1S/C29H33F5N2O3/c1-17(28(37)38)16-36-25(29(32,33)34)15-21-20-7-4-3-6-19(20)14-22(21)27(36)26-18(2)24(9-8-23(26)31)39-13-12-35-11-5-10-30/h3-4,6-9,17,25,27,35H,5,10-16H2,1-2H3,(H,37,38)/t17-,25-,27-/m0/s1 |
| InChIKey | CVEROBJWFBTQMB-CCXQXCJASA-N |
| XLogP | 5.87 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.58 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|