C28H31ClF4N2O3 — CID 158831329
(2S)-3-[(1S,3S)-1-[2-chloro-6-fluoro-3-[2-(3-fluoropropylamino)ethoxy]phenyl]-3-(difluoromethyl)-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-2-methylpropanoic acid (PubChem CID 158831329) has the molecular formula C28H31ClF4N2O3 and a molecular weight of 555.01 g/mol. Its IUPAC name is (2S)-3-[(1S,3S)-1-[2-chloro-6-fluoro-3-[2-(3-fluoropropylamino)ethoxy]phenyl]-3-(difluoromethyl)-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-2-methylpropanoic acid.
| Compound Name | (2S)-3-[(1S,3S)-1-[2-chloro-6-fluoro-3-[2-(3-fluoropropylamino)ethoxy]phenyl]-3-(difluoromethyl)-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 158831329 |
| Molecular Formula | C28H31ClF4N2O3 |
| Molecular Weight | 555.01 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | (2S)-3-[(1S,3S)-1-[2-chloro-6-fluoro-3-[2-(3-fluoropropylamino)ethoxy]phenyl]-3-(difluoromethyl)-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-2-methylpropanoic acid |
| SMILES | C[C@@H](CN1[C@H](c2c(F)ccc(OCCNCCCF)c2Cl)C2=C(C[C@H]1C(F)F)c1ccccc1C2)C(=O)O |
| InChI | InChI=1S/C28H31ClF4N2O3/c1-16(28(36)37)15-35-22(27(32)33)14-19-18-6-3-2-5-17(18)13-20(19)26(35)24-21(31)7-8-23(25(24)29)38-12-11-34-10-4-9-30/h2-3,5-8,16,22,26-27,34H,4,9-15H2,1H3,(H,36,37)/t16-,22-,26-/m0/s1 |
| InChIKey | IXBSNWOIIAXYGZ-YZKRRQQXSA-N |
| XLogP | 5.92 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.01 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|