C24H27BrF2N2O2 — CID 163980045
methyl 3-[(1R,3R)-1-(3-bromo-6-fluoro-2-methylcyclohexa-1,5-dien-1-yl)-6-fluoro-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylpropanoate (PubChem CID 163980045) has the molecular formula C24H27BrF2N2O2 and a molecular weight of 493.39 g/mol. Its IUPAC name is methyl 3-[(1R,3R)-1-(3-bromo-6-fluoro-2-methylcyclohexa-1,5-dien-1-yl)-6-fluoro-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylpropanoate.
| Compound Name | methyl 3-[(1R,3R)-1-(3-bromo-6-fluoro-2-methylcyclohexa-1,5-dien-1-yl)-6-fluoro-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylpropanoate |
|---|---|
| PubChem CID | 163980045 |
| Molecular Formula | C24H27BrF2N2O2 |
| Molecular Weight | 493.39 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | methyl 3-[(1R,3R)-1-(3-bromo-6-fluoro-2-methylcyclohexa-1,5-dien-1-yl)-6-fluoro-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylpropanoate |
| SMILES | COC(=O)C(C)CN1[C@H](C)Cc2c([nH]c3ccc(F)cc23)[C@H]1C1=C(C)C(Br)CC=C1F |
| InChI | InChI=1S/C24H27BrF2N2O2/c1-12(24(30)31-4)11-29-13(2)9-17-16-10-15(26)5-8-20(16)28-22(17)23(29)21-14(3)18(25)6-7-19(21)27/h5,7-8,10,12-13,18,23,28H,6,9,11H2,1-4H3/t12?,13-,18?,23-/m1/s1 |
| InChIKey | SXOWHFQHUQKEAK-QIKQAKPGSA-N |
| XLogP | 5.74 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.39 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|