C25H30F4N4O — CID 155032559
N-(3-fluoropropyl)-N'-[4-methoxy-3-[2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]ethane-1,2-diamine (PubChem CID 155032559) has the molecular formula C25H30F4N4O and a molecular weight of 478.53 g/mol. Its IUPAC name is N-(3-fluoropropyl)-N'-[4-methoxy-3-[2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]ethane-1,2-diamine.
| Compound Name | N-(3-fluoropropyl)-N'-[4-methoxy-3-[2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 155032559 |
| Molecular Formula | C25H30F4N4O |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | N-(3-fluoropropyl)-N'-[4-methoxy-3-[2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]ethane-1,2-diamine |
| SMILES | COc1ccc(NCCNCCCF)cc1C1c2[nH]c3ccccc3c2CCN1CC(F)(F)F |
| InChI | InChI=1S/C25H30F4N4O/c1-34-22-8-7-17(31-13-12-30-11-4-10-26)15-20(22)24-23-19(9-14-33(24)16-25(27,28)29)18-5-2-3-6-21(18)32-23/h2-3,5-8,15,24,30-32H,4,9-14,16H2,1H3 |
| InChIKey | PIZZONQQZOABRL-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|