C31H38F5N3O3 — CID 163479576
tert-butyl N-butyl-N-[2-[2,4-difluoro-3-[(1R,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethyl]carbamate (PubChem CID 163479576) has the molecular formula C31H38F5N3O3 and a molecular weight of 595.65 g/mol. Its IUPAC name is tert-butyl N-butyl-N-[2-[2,4-difluoro-3-[(1R,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-butyl-N-[2-[2,4-difluoro-3-[(1R,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 163479576 |
| Molecular Formula | C31H38F5N3O3 |
| Molecular Weight | 595.65 g/mol |
| Exact Mass | 595.28 |
| IUPAC Name | tert-butyl N-butyl-N-[2-[2,4-difluoro-3-[(1R,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethyl]carbamate |
| SMILES | CCCCN(CCOc1ccc(F)c([C@@H]2c3[nH]c4ccccc4c3C[C@@H](C)N2CC(F)(F)F)c1F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H38F5N3O3/c1-6-7-14-38(29(40)42-30(3,4)5)15-16-41-24-13-12-22(32)25(26(24)33)28-27-21(20-10-8-9-11-23(20)37-27)17-19(2)39(28)18-31(34,35)36/h8-13,19,28,37H,6-7,14-18H2,1-5H3/t19-,28-/m1/s1 |
| InChIKey | CDJCIZAMNLHUED-WHLCRQNOSA-N |
| XLogP | 7.76 |
| TPSA | 57.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.65 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|