C33H43F2N3O5 — CID 135277191
tert-butyl N-[2-[3-[(1R,3R)-2-[(3-fluorooxetan-3-yl)methyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-2-methoxyphenoxy]ethyl]-N-(3-fluoropropyl)carbamate (PubChem CID 135277191) has the molecular formula C33H43F2N3O5 and a molecular weight of 599.72 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[(1R,3R)-2-[(3-fluorooxetan-3-yl)methyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-2-methoxyphenoxy]ethyl]-N-(3-fluoropropyl)carbamate.
| Compound Name | tert-butyl N-[2-[3-[(1R,3R)-2-[(3-fluorooxetan-3-yl)methyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-2-methoxyphenoxy]ethyl]-N-(3-fluoropropyl)carbamate |
|---|---|
| PubChem CID | 135277191 |
| Molecular Formula | C33H43F2N3O5 |
| Molecular Weight | 599.72 g/mol |
| Exact Mass | 599.32 |
| IUPAC Name | tert-butyl N-[2-[3-[(1R,3R)-2-[(3-fluorooxetan-3-yl)methyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-2-methoxyphenoxy]ethyl]-N-(3-fluoropropyl)carbamate |
| SMILES | COc1c(OCCN(CCCF)C(=O)OC(C)(C)C)cccc1[C@@H]1c2[nH]c3ccccc3c2C[C@@H](C)N1CC1(F)COC1 |
| InChI | InChI=1S/C33H43F2N3O5/c1-22-18-25-23-10-6-7-12-26(23)36-28(25)29(38(22)19-33(35)20-41-21-33)24-11-8-13-27(30(24)40-5)42-17-16-37(15-9-14-34)31(39)43-32(2,3)4/h6-8,10-13,22,29,36H,9,14-21H2,1-5H3/t22-,29-/m1/s1 |
| InChIKey | FCXNHEITXVXSGW-KPURRNSFSA-N |
| XLogP | 6.23 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.72 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|