C35H38F4N4O3 — CID 134199659
benzyl N-[2-[3,5-difluoro-4-[(1R,3R)-2-[(3-fluorooxetan-3-yl)methyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]anilino]ethyl]-N-(3-fluoropropyl)carbamate (PubChem CID 134199659) has the molecular formula C35H38F4N4O3 and a molecular weight of 638.71 g/mol. Its IUPAC name is benzyl N-[2-[3,5-difluoro-4-[(1R,3R)-2-[(3-fluorooxetan-3-yl)methyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]anilino]ethyl]-N-(3-fluoropropyl)carbamate.
| Compound Name | benzyl N-[2-[3,5-difluoro-4-[(1R,3R)-2-[(3-fluorooxetan-3-yl)methyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]anilino]ethyl]-N-(3-fluoropropyl)carbamate |
|---|---|
| PubChem CID | 134199659 |
| Molecular Formula | C35H38F4N4O3 |
| Molecular Weight | 638.71 g/mol |
| Exact Mass | 638.29 |
| IUPAC Name | benzyl N-[2-[3,5-difluoro-4-[(1R,3R)-2-[(3-fluorooxetan-3-yl)methyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]anilino]ethyl]-N-(3-fluoropropyl)carbamate |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2c(F)cc(NCCN(CCCF)C(=O)OCc3ccccc3)cc2F)N1CC1(F)COC1 |
| InChI | InChI=1S/C35H38F4N4O3/c1-23-16-27-26-10-5-6-11-30(26)41-32(27)33(43(23)20-35(39)21-45-22-35)31-28(37)17-25(18-29(31)38)40-13-15-42(14-7-12-36)34(44)46-19-24-8-3-2-4-9-24/h2-6,8-11,17-18,23,33,40-41H,7,12-16,19-22H2,1H3/t23-,33-/m1/s1 |
| InChIKey | DIUXKNITFXNXOG-PVAZPRTOSA-N |
| XLogP | 6.93 |
| TPSA | 69.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.71 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|