C36H42F2N4O4 — CID 134199634
benzyl N-[2-[4-[(1R,3R)-2-[(3-fluorooxetan-3-yl)methyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3-methoxyanilino]ethyl]-N-(3-fluoropropyl)carbamate (PubChem CID 134199634) has the molecular formula C36H42F2N4O4 and a molecular weight of 632.75 g/mol. Its IUPAC name is benzyl N-[2-[4-[(1R,3R)-2-[(3-fluorooxetan-3-yl)methyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3-methoxyanilino]ethyl]-N-(3-fluoropropyl)carbamate.
| Compound Name | benzyl N-[2-[4-[(1R,3R)-2-[(3-fluorooxetan-3-yl)methyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3-methoxyanilino]ethyl]-N-(3-fluoropropyl)carbamate |
|---|---|
| PubChem CID | 134199634 |
| Molecular Formula | C36H42F2N4O4 |
| Molecular Weight | 632.75 g/mol |
| Exact Mass | 632.32 |
| IUPAC Name | benzyl N-[2-[4-[(1R,3R)-2-[(3-fluorooxetan-3-yl)methyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3-methoxyanilino]ethyl]-N-(3-fluoropropyl)carbamate |
| SMILES | COc1cc(NCCN(CCCF)C(=O)OCc2ccccc2)ccc1[C@@H]1c2[nH]c3ccccc3c2C[C@@H](C)N1CC1(F)COC1 |
| InChI | InChI=1S/C36H42F2N4O4/c1-25-19-30-28-11-6-7-12-31(28)40-33(30)34(42(25)22-36(38)23-45-24-36)29-14-13-27(20-32(29)44-2)39-16-18-41(17-8-15-37)35(43)46-21-26-9-4-3-5-10-26/h3-7,9-14,20,25,34,39-40H,8,15-19,21-24H2,1-2H3/t25-,34-/m1/s1 |
| InChIKey | PGEJHSDLRSMGLV-QCBOHVIISA-N |
| XLogP | 6.66 |
| TPSA | 79.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.75 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|