C24H24BrF3N2O2 — CID 134199612
(1R,3R)-1-[4-(2-bromoethoxy)-2,6-difluorophenyl]-2-[(3-fluorooxetan-3-yl)methyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 134199612) has the molecular formula C24H24BrF3N2O2 and a molecular weight of 509.37 g/mol. Its IUPAC name is (1R,3R)-1-[4-(2-bromoethoxy)-2,6-difluorophenyl]-2-[(3-fluorooxetan-3-yl)methyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1R,3R)-1-[4-(2-bromoethoxy)-2,6-difluorophenyl]-2-[(3-fluorooxetan-3-yl)methyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 134199612 |
| Molecular Formula | C24H24BrF3N2O2 |
| Molecular Weight | 509.37 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | (1R,3R)-1-[4-(2-bromoethoxy)-2,6-difluorophenyl]-2-[(3-fluorooxetan-3-yl)methyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2c(F)cc(OCCBr)cc2F)N1CC1(F)COC1 |
| InChI | InChI=1S/C24H24BrF3N2O2/c1-14-8-17-16-4-2-3-5-20(16)29-22(17)23(30(14)11-24(28)12-31-13-24)21-18(26)9-15(10-19(21)27)32-7-6-25/h2-5,9-10,14,23,29H,6-8,11-13H2,1H3/t14-,23-/m1/s1 |
| InChIKey | DUHLCMQDIVQDKL-QKFKETGDSA-N |
| XLogP | 5.29 |
| TPSA | 37.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.37 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|