C26H26F2N2 — CID 145378169
(1R,3R)-2-(cyclobuta-1,2-dien-1-ylmethyl)-1-[2,6-difluoro-4-[(E)-prop-1-enyl]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole;molecular hydrogen (PubChem CID 145378169) has the molecular formula C26H26F2N2 and a molecular weight of 404.50 g/mol. Its IUPAC name is (1R,3R)-2-(cyclobuta-1,2-dien-1-ylmethyl)-1-[2,6-difluoro-4-[(E)-prop-1-enyl]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole;molecular hydrogen.
| Compound Name | (1R,3R)-2-(cyclobuta-1,2-dien-1-ylmethyl)-1-[2,6-difluoro-4-[(E)-prop-1-enyl]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole;molecular hydrogen |
|---|---|
| PubChem CID | 145378169 |
| Molecular Formula | C26H26F2N2 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | (1R,3R)-2-(cyclobuta-1,2-dien-1-ylmethyl)-1-[2,6-difluoro-4-[(E)-prop-1-enyl]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole;molecular hydrogen |
| SMILES | C/C=C/c1cc(F)c([C@@H]2c3[nH]c4ccccc4c3C[C@@H](C)N2CC2=C=CC2)c(F)c1.[H][H] |
| InChI | InChI=1S/C26H24F2N2.H2/c1-3-7-18-13-21(27)24(22(28)14-18)26-25-20(19-10-4-5-11-23(19)29-25)12-16(2)30(26)15-17-8-6-9-17;/h3-7,10-11,13-14,16,26,29H,8,12,15H2,1-2H3;1H/b7-3+;/t16-,26-;/m1./s1 |
| InChIKey | TXSFQSCXHCQTTI-IUTXPFJKSA-N |
| XLogP | 6.55 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|