C29H30F2N2O2 — CID 131979129
(E)-3-[4-[2-(2-bicyclo[2.1.1]hexanylmethyl)-3,3-dimethyl-4,9-dihydro-1H-pyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]prop-2-enoic acid (PubChem CID 131979129) has the molecular formula C29H30F2N2O2 and a molecular weight of 476.57 g/mol. Its IUPAC name is (E)-3-[4-[2-(2-bicyclo[2.1.1]hexanylmethyl)-3,3-dimethyl-4,9-dihydro-1H-pyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[2-(2-bicyclo[2.1.1]hexanylmethyl)-3,3-dimethyl-4,9-dihydro-1H-pyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 131979129 |
| Molecular Formula | C29H30F2N2O2 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | (E)-3-[4-[2-(2-bicyclo[2.1.1]hexanylmethyl)-3,3-dimethyl-4,9-dihydro-1H-pyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]prop-2-enoic acid |
| SMILES | CC1(C)Cc2c([nH]c3ccccc23)C(c2c(F)cc(/C=C/C(=O)O)cc2F)N1CC1CC2CC1C2 |
| InChI | InChI=1S/C29H30F2N2O2/c1-29(2)14-21-20-5-3-4-6-24(20)32-27(21)28(33(29)15-19-11-17-9-18(19)10-17)26-22(30)12-16(13-23(26)31)7-8-25(34)35/h3-8,12-13,17-19,28,32H,9-11,14-15H2,1-2H3,(H,34,35)/b8-7+ |
| InChIKey | FKOJDQFWAQFLGF-BQYQJAHWSA-N |
| XLogP | 6.32 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|