C26H29FN2O2 — CID 123439303
3-[4-[2-(3-fluoro-2-methylpropyl)-3,3-dimethyl-4,9-dihydro-1H-pyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid (PubChem CID 123439303) has the molecular formula C26H29FN2O2 and a molecular weight of 420.53 g/mol. Its IUPAC name is 3-[4-[2-(3-fluoro-2-methylpropyl)-3,3-dimethyl-4,9-dihydro-1H-pyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[2-(3-fluoro-2-methylpropyl)-3,3-dimethyl-4,9-dihydro-1H-pyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 123439303 |
| Molecular Formula | C26H29FN2O2 |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 3-[4-[2-(3-fluoro-2-methylpropyl)-3,3-dimethyl-4,9-dihydro-1H-pyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid |
| SMILES | CC(CF)CN1C(c2ccc(C=CC(=O)O)cc2)c2[nH]c3ccccc3c2CC1(C)C |
| InChI | InChI=1S/C26H29FN2O2/c1-17(15-27)16-29-25(19-11-8-18(9-12-19)10-13-23(30)31)24-21(14-26(29,2)3)20-6-4-5-7-22(20)28-24/h4-13,17,25,28H,14-16H2,1-3H3,(H,30,31) |
| InChIKey | WRHLOSDZEZAYKX-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|