C26H28F2N2O2 — CID 86342656
(E)-3-[3-fluoro-4-[2-[(2S)-3-fluoro-2-methylpropyl]-3,3-dimethyl-4,9-dihydro-1H-pyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid (PubChem CID 86342656) has the molecular formula C26H28F2N2O2 and a molecular weight of 438.52 g/mol. Its IUPAC name is (E)-3-[3-fluoro-4-[2-[(2S)-3-fluoro-2-methylpropyl]-3,3-dimethyl-4,9-dihydro-1H-pyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-fluoro-4-[2-[(2S)-3-fluoro-2-methylpropyl]-3,3-dimethyl-4,9-dihydro-1H-pyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 86342656 |
| Molecular Formula | C26H28F2N2O2 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | (E)-3-[3-fluoro-4-[2-[(2S)-3-fluoro-2-methylpropyl]-3,3-dimethyl-4,9-dihydro-1H-pyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid |
| SMILES | C[C@H](CF)CN1C(c2ccc(/C=C/C(=O)O)cc2F)c2[nH]c3ccccc3c2CC1(C)C |
| InChI | InChI=1S/C26H28F2N2O2/c1-16(14-27)15-30-25(19-10-8-17(12-21(19)28)9-11-23(31)32)24-20(13-26(30,2)3)18-6-4-5-7-22(18)29-24/h4-12,16,25,29H,13-15H2,1-3H3,(H,31,32)/b11-9+/t16-,25?/m1/s1 |
| InChIKey | IOPRLAHXDGSIHG-NAUGMMEESA-N |
| XLogP | 5.74 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|