C24H29NO3 — CID 127034418
(E)-3-[4-[(1R)-6-hydroxy-3,3-dimethyl-2-(2-methylpropyl)-1,4-dihydroisoquinolin-1-yl]phenyl]prop-2-enoic acid (PubChem CID 127034418) has the molecular formula C24H29NO3 and a molecular weight of 379.50 g/mol. Its IUPAC name is (E)-3-[4-[(1R)-6-hydroxy-3,3-dimethyl-2-(2-methylpropyl)-1,4-dihydroisoquinolin-1-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(1R)-6-hydroxy-3,3-dimethyl-2-(2-methylpropyl)-1,4-dihydroisoquinolin-1-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 127034418 |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | (E)-3-[4-[(1R)-6-hydroxy-3,3-dimethyl-2-(2-methylpropyl)-1,4-dihydroisoquinolin-1-yl]phenyl]prop-2-enoic acid |
| SMILES | CC(C)CN1[C@H](c2ccc(/C=C/C(=O)O)cc2)c2ccc(O)cc2CC1(C)C |
| InChI | InChI=1S/C24H29NO3/c1-16(2)15-25-23(18-8-5-17(6-9-18)7-12-22(27)28)21-11-10-20(26)13-19(21)14-24(25,3)4/h5-13,16,23,26H,14-15H2,1-4H3,(H,27,28)/b12-7+/t23-/m1/s1 |
| InChIKey | ZQKFNPVWSXKPCE-QMZDIEEXSA-N |
| XLogP | 4.87 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|