C27H29F5N2O5 — CID 138693767
2-[3-[2-[3,5-difluoro-4-[(1R,3R)-3-(1,1,1-trifluoropropan-2-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]phenoxy]ethoxy]propoxy]acetic acid (PubChem CID 138693767) has the molecular formula C27H29F5N2O5 and a molecular weight of 556.53 g/mol. Its IUPAC name is 2-[3-[2-[3,5-difluoro-4-[(1R,3R)-3-(1,1,1-trifluoropropan-2-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]phenoxy]ethoxy]propoxy]acetic acid.
| Compound Name | 2-[3-[2-[3,5-difluoro-4-[(1R,3R)-3-(1,1,1-trifluoropropan-2-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]phenoxy]ethoxy]propoxy]acetic acid |
|---|---|
| PubChem CID | 138693767 |
| Molecular Formula | C27H29F5N2O5 |
| Molecular Weight | 556.53 g/mol |
| Exact Mass | 556.20 |
| IUPAC Name | 2-[3-[2-[3,5-difluoro-4-[(1R,3R)-3-(1,1,1-trifluoropropan-2-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]phenoxy]ethoxy]propoxy]acetic acid |
| SMILES | CC([C@H]1Cc2c([nH]c3ccccc23)[C@@H](c2c(F)cc(OCCOCCCOCC(=O)O)cc2F)N1)C(F)(F)F |
| InChI | InChI=1S/C27H29F5N2O5/c1-15(27(30,31)32)22-13-18-17-5-2-3-6-21(17)33-25(18)26(34-22)24-19(28)11-16(12-20(24)29)39-10-9-37-7-4-8-38-14-23(35)36/h2-3,5-6,11-12,15,22,26,33-34H,4,7-10,13-14H2,1H3,(H,35,36)/t15?,22-,26-/m1/s1 |
| InChIKey | YWTZUGMXKLYUAP-PNKXUSIBSA-N |
| XLogP | 5.13 |
| TPSA | 92.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.53 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|