C28H25F4N3O — CID 170727883
3-[(E)-2-[4-[(3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]prop-1-enyl]iminopent-4-yn-2-one (PubChem CID 170727883) has the molecular formula C28H25F4N3O and a molecular weight of 495.52 g/mol. Its IUPAC name is 3-[(E)-2-[4-[(3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]prop-1-enyl]iminopent-4-yn-2-one.
| Compound Name | 3-[(E)-2-[4-[(3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]prop-1-enyl]iminopent-4-yn-2-one |
|---|---|
| PubChem CID | 170727883 |
| Molecular Formula | C28H25F4N3O |
| Molecular Weight | 495.52 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | 3-[(E)-2-[4-[(3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]prop-1-enyl]iminopent-4-yn-2-one |
| SMILES | C#C/C(=N\C=C(/C)c1cc(F)c(C2c3[nH]c4ccccc4c3C[C@@H](C)N2CC(F)F)c(F)c1)C(C)=O |
| InChI | InChI=1S/C28H25F4N3O/c1-5-23(17(4)36)33-13-15(2)18-11-21(29)26(22(30)12-18)28-27-20(10-16(3)35(28)14-25(31)32)19-8-6-7-9-24(19)34-27/h1,6-9,11-13,16,25,28,34H,10,14H2,2-4H3/b15-13+,33-23+/t16-,28?/m1/s1 |
| InChIKey | ZDUYVPPZWYZJCV-IXABUTJYSA-N |
| XLogP | 6.07 |
| TPSA | 48.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.52 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|