C24H23BrF2N2O — CID 164561337
[3-[(1R,3R)-1-(4-bromo-2,6-difluorophenyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-1-bicyclo[1.1.1]pentanyl]methanol (PubChem CID 164561337) has the molecular formula C24H23BrF2N2O and a molecular weight of 473.36 g/mol. Its IUPAC name is [3-[(1R,3R)-1-(4-bromo-2,6-difluorophenyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-1-bicyclo[1.1.1]pentanyl]methanol.
| Compound Name | [3-[(1R,3R)-1-(4-bromo-2,6-difluorophenyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-1-bicyclo[1.1.1]pentanyl]methanol |
|---|---|
| PubChem CID | 164561337 |
| Molecular Formula | C24H23BrF2N2O |
| Molecular Weight | 473.36 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | [3-[(1R,3R)-1-(4-bromo-2,6-difluorophenyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-1-bicyclo[1.1.1]pentanyl]methanol |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2c(F)cc(Br)cc2F)N1C12CC(CO)(C1)C2 |
| InChI | InChI=1S/C24H23BrF2N2O/c1-13-6-16-15-4-2-3-5-19(15)28-21(16)22(20-17(26)7-14(25)8-18(20)27)29(13)24-9-23(10-24,11-24)12-30/h2-5,7-8,13,22,28,30H,6,9-12H2,1H3/t13-,22-,23?,24?/m1/s1 |
| InChIKey | QQYNSYHOTNOJQV-PFVXVJQZSA-N |
| XLogP | 5.46 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.36 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|