C27H22F4N2O2 — CID 138643121
(E)-3-[(3R,14S)-16-fluoro-3-methyl-22-(trifluoromethyl)-2,12-diazaheptacyclo[20.1.1.01,21.02,14.05,13.06,11.015,20]tetracosa-5(13),6,8,10,15(20),16,18-heptaen-18-yl]prop-2-enoic acid (PubChem CID 138643121) has the molecular formula C27H22F4N2O2 and a molecular weight of 482.48 g/mol. Its IUPAC name is (E)-3-[(3R,14S)-16-fluoro-3-methyl-22-(trifluoromethyl)-2,12-diazaheptacyclo[20.1.1.01,21.02,14.05,13.06,11.015,20]tetracosa-5(13),6,8,10,15(20),16,18-heptaen-18-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[(3R,14S)-16-fluoro-3-methyl-22-(trifluoromethyl)-2,12-diazaheptacyclo[20.1.1.01,21.02,14.05,13.06,11.015,20]tetracosa-5(13),6,8,10,15(20),16,18-heptaen-18-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 138643121 |
| Molecular Formula | C27H22F4N2O2 |
| Molecular Weight | 482.48 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | (E)-3-[(3R,14S)-16-fluoro-3-methyl-22-(trifluoromethyl)-2,12-diazaheptacyclo[20.1.1.01,21.02,14.05,13.06,11.015,20]tetracosa-5(13),6,8,10,15(20),16,18-heptaen-18-yl]prop-2-enoic acid |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H]2c3c(F)cc(/C=C/C(=O)O)cc3C3C4(CC3(C(F)(F)F)C4)N21 |
| InChI | InChI=1S/C27H22F4N2O2/c1-13-8-16-15-4-2-3-5-19(15)32-22(16)23-21-17(9-14(10-18(21)28)6-7-20(34)35)24-25(27(29,30)31)11-26(24,12-25)33(13)23/h2-7,9-10,13,23-24,32H,8,11-12H2,1H3,(H,34,35)/b7-6+/t13-,23+,24?,25?,26?/m1/s1 |
| InChIKey | XJDUTWGSUSRLOR-KHYWQKHSSA-N |
| XLogP | 5.93 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.48 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|