C28H30F8N4O — CID 171059590
(3S,4S)-N-[3-(difluoromethoxy)-4-[(3R)-8-fluoro-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-4-fluoro-1-(3-fluoropropyl)pyrrolidin-3-amine (PubChem CID 171059590) has the molecular formula C28H30F8N4O and a molecular weight of 590.56 g/mol. Its IUPAC name is (3S,4S)-N-[3-(difluoromethoxy)-4-[(3R)-8-fluoro-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-4-fluoro-1-(3-fluoropropyl)pyrrolidin-3-amine.
| Compound Name | (3S,4S)-N-[3-(difluoromethoxy)-4-[(3R)-8-fluoro-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-4-fluoro-1-(3-fluoropropyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 171059590 |
| Molecular Formula | C28H30F8N4O |
| Molecular Weight | 590.56 g/mol |
| Exact Mass | 590.23 |
| IUPAC Name | (3S,4S)-N-[3-(difluoromethoxy)-4-[(3R)-8-fluoro-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-4-fluoro-1-(3-fluoropropyl)pyrrolidin-3-amine |
| SMILES | C[C@@H]1Cc2c([nH]c3c(F)cccc23)C(c2ccc(N[C@H]3CN(CCCF)C[C@@H]3F)cc2OC(F)F)N1CC(F)(F)F |
| InChI | InChI=1S/C28H30F8N4O/c1-15-10-19-17-4-2-5-20(30)24(17)38-25(19)26(40(15)14-28(34,35)36)18-7-6-16(11-23(18)41-27(32)33)37-22-13-39(9-3-8-29)12-21(22)31/h2,4-7,11,15,21-22,26-27,37-38H,3,8-10,12-14H2,1H3/t15-,21+,22+,26?/m1/s1 |
| InChIKey | NIEHZSDQCMUIQA-CVHJHWMRSA-N |
| XLogP | 6.60 |
| TPSA | 43.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.56 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|