C30H30F2N2O3 — CID 135234626
4-[3-fluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-5-methoxyphenyl]benzoic acid (PubChem CID 135234626) has the molecular formula C30H30F2N2O3 and a molecular weight of 504.58 g/mol. Its IUPAC name is 4-[3-fluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-5-methoxyphenyl]benzoic acid.
| Compound Name | 4-[3-fluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-5-methoxyphenyl]benzoic acid |
|---|---|
| PubChem CID | 135234626 |
| Molecular Formula | C30H30F2N2O3 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | 4-[3-fluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-5-methoxyphenyl]benzoic acid |
| SMILES | COc1cc(-c2ccc(C(=O)O)cc2)cc(F)c1[C@@H]1c2[nH]c3ccccc3c2C[C@@H](C)N1CC(C)(C)F |
| InChI | InChI=1S/C30H30F2N2O3/c1-17-13-22-21-7-5-6-8-24(21)33-27(22)28(34(17)16-30(2,3)32)26-23(31)14-20(15-25(26)37-4)18-9-11-19(12-10-18)29(35)36/h5-12,14-15,17,28,33H,13,16H2,1-4H3,(H,35,36)/t17-,28-/m1/s1 |
| InChIKey | UHWRGBXGFZNMKY-JYRCXFKTSA-N |
| XLogP | 6.76 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|