C31H33F2N3O — CID 69382407
(3,5-difluorophenyl)-[1-[3-(dimethylamino)-3-phenylpentyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone (PubChem CID 69382407) has the molecular formula C31H33F2N3O and a molecular weight of 501.62 g/mol. Its IUPAC name is (3,5-difluorophenyl)-[1-[3-(dimethylamino)-3-phenylpentyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone.
| Compound Name | (3,5-difluorophenyl)-[1-[3-(dimethylamino)-3-phenylpentyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
|---|---|
| PubChem CID | 69382407 |
| Molecular Formula | C31H33F2N3O |
| Molecular Weight | 501.62 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | (3,5-difluorophenyl)-[1-[3-(dimethylamino)-3-phenylpentyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
| SMILES | CCC(CCC1c2[nH]c3ccccc3c2CCN1C(=O)c1cc(F)cc(F)c1)(c1ccccc1)N(C)C |
| InChI | InChI=1S/C31H33F2N3O/c1-4-31(35(2)3,22-10-6-5-7-11-22)16-14-28-29-26(25-12-8-9-13-27(25)34-29)15-17-36(28)30(37)21-18-23(32)20-24(33)19-21/h5-13,18-20,28,34H,4,14-17H2,1-3H3 |
| InChIKey | INQBHBDZFLFDGT-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.62 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|