C26H26N2O4 — CID 71747977
2-methoxy-6-(3,4,5-trimethoxyphenyl)-5,6,7,12-tetrahydroindolo[2,3-c][1]benzazepine (PubChem CID 71747977) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is 2-methoxy-6-(3,4,5-trimethoxyphenyl)-5,6,7,12-tetrahydroindolo[2,3-c][1]benzazepine.
| Compound Name | 2-methoxy-6-(3,4,5-trimethoxyphenyl)-5,6,7,12-tetrahydroindolo[2,3-c][1]benzazepine |
|---|---|
| PubChem CID | 71747977 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 2-methoxy-6-(3,4,5-trimethoxyphenyl)-5,6,7,12-tetrahydroindolo[2,3-c][1]benzazepine |
| SMILES | COc1ccc2[nH]c3c(c2c1)Cc1ccccc1NC3c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C26H26N2O4/c1-29-17-9-10-21-18(14-17)19-11-15-7-5-6-8-20(15)27-24(25(19)28-21)16-12-22(30-2)26(32-4)23(13-16)31-3/h5-10,12-14,24,27-28H,11H2,1-4H3 |
| InChIKey | RZBPHMAZNMAPCB-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|