C23H31N3O — CID 59014623
[8-(cyclohexylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]-pyrrolidin-1-ylmethanone (PubChem CID 59014623) has the molecular formula C23H31N3O and a molecular weight of 365.52 g/mol. Its IUPAC name is [8-(cyclohexylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [8-(cyclohexylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 59014623 |
| Molecular Formula | C23H31N3O |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.25 |
| IUPAC Name | [8-(cyclohexylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1ccc2[nH]c3c(c2c1)CCCC3NC1CCCCC1)N1CCCC1 |
| InChI | InChI=1S/C23H31N3O/c27-23(26-13-4-5-14-26)16-11-12-20-19(15-16)18-9-6-10-21(22(18)25-20)24-17-7-2-1-3-8-17/h11-12,15,17,21,24-25H,1-10,13-14H2 |
| InChIKey | OVMMADAPLTXAAC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|