C24H26N6O — CID 166231016
5,6,7,8,9,10-hexahydrocyclohepta[b]indol-2-yl-[4-([1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone (PubChem CID 166231016) has the molecular formula C24H26N6O and a molecular weight of 414.51 g/mol. Its IUPAC name is 5,6,7,8,9,10-hexahydrocyclohepta[b]indol-2-yl-[4-([1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone.
| Compound Name | 5,6,7,8,9,10-hexahydrocyclohepta[b]indol-2-yl-[4-([1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 166231016 |
| Molecular Formula | C24H26N6O |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 5,6,7,8,9,10-hexahydrocyclohepta[b]indol-2-yl-[4-([1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc2[nH]c3c(c2c1)CCCCC3)N1CCC(c2nnc3cnccn23)CC1 |
| InChI | InChI=1S/C24H26N6O/c31-24(17-6-7-21-19(14-17)18-4-2-1-3-5-20(18)26-21)29-11-8-16(9-12-29)23-28-27-22-15-25-10-13-30(22)23/h6-7,10,13-16,26H,1-5,8-9,11-12H2 |
| InChIKey | CKCUULXCNXEEII-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|