C27H32FN3O — CID 11339489
8-(cyclohexylamino)-N-[2-(4-fluorophenyl)ethyl]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide (PubChem CID 11339489) has the molecular formula C27H32FN3O and a molecular weight of 433.57 g/mol. Its IUPAC name is 8-(cyclohexylamino)-N-[2-(4-fluorophenyl)ethyl]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide.
| Compound Name | 8-(cyclohexylamino)-N-[2-(4-fluorophenyl)ethyl]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 11339489 |
| Molecular Formula | C27H32FN3O |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | 8-(cyclohexylamino)-N-[2-(4-fluorophenyl)ethyl]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
| SMILES | O=C(NCCc1ccc(F)cc1)c1ccc2[nH]c3c(c2c1)CCCC3NC1CCCCC1 |
| InChI | InChI=1S/C27H32FN3O/c28-20-12-9-18(10-13-20)15-16-29-27(32)19-11-14-24-23(17-19)22-7-4-8-25(26(22)31-24)30-21-5-2-1-3-6-21/h9-14,17,21,25,30-31H,1-8,15-16H2,(H,29,32) |
| InChIKey | XCYPAXWSFJNXBT-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|