C18H16FN3O — CID 97426241
N-[(1S)-6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-1-yl]pyridine-4-carboxamide (PubChem CID 97426241) has the molecular formula C18H16FN3O and a molecular weight of 309.34 g/mol. Its IUPAC name is N-[(1S)-6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-1-yl]pyridine-4-carboxamide.
| Compound Name | N-[(1S)-6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-1-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 97426241 |
| Molecular Formula | C18H16FN3O |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | N-[(1S)-6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-1-yl]pyridine-4-carboxamide |
| SMILES | O=C(N[C@H]1CCCc2c1[nH]c1ccc(F)cc21)c1ccncc1 |
| InChI | InChI=1S/C18H16FN3O/c19-12-4-5-15-14(10-12)13-2-1-3-16(17(13)21-15)22-18(23)11-6-8-20-9-7-11/h4-10,16,21H,1-3H2,(H,22,23)/t16-/m0/s1 |
| InChIKey | JOHOANJALAIGRY-INIZCTEOSA-N |
| XLogP | 3.51 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|